Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Mangiferin has been shown to have the effect of improving dyslipidemia. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12088 |
|---|---|
| Formula | C19H18O11 |
| Molecular Weight | 422.33 |
| CAS Number | 4773-96-0 |
| SMILES | C1=C2C(=CC(=C1O)O)OC3=CC(=C(C(=C3C2=O)O)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
| Synonyms | Alpizarine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (187.05 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.68 mL | 118.39 mL | 236.78 mL |
| 0.5 mM | 4.74 mL | 23.68 mL | 47.36 mL |
| 1 mM | 2.37 mL | 11.84 mL | 23.68 mL |
| 5 mM | 0.47 mL | 2.37 mL | 4.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
