Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Memantine hydrochloride is an antagonist at the NMDA receptor, binding to the ion channel site. it was used in the treatment of Parkinsonism. |
|---|
| Catalog Num | A11708 |
|---|---|
| Formula | C12H21N.HCl |
| Molecular Weight | 215.8 |
| CAS Number | 41100-52-1 |
| SMILES | CC12CC3CC(C1)(CC(C3)(C2)N)C.Cl |
| Synonyms | Namenda |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 40 mg/mL (185.39 mM) | |
| Water | 28 mg/mL (129.77 mM) | ||
| Ethanol | 40 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.34 mL | 231.7 mL | 463.39 mL |
| 0.5 mM | 9.27 mL | 46.34 mL | 92.68 mL |
| 1 mM | 4.63 mL | 23.17 mL | 46.34 mL |
| 5 mM | 0.93 mL | 4.63 mL | 9.27 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
