Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Meropenem is a β-lactam antibiotic of the carbapenem subclass that has been shown to inhibit penicillinase-negative, -positive and methicillin-susceptible staphylococci. |
|---|
| Catalog Num | A10569 |
|---|---|
| Formula | C17H25N3O5S |
| Molecular Weight | 383.46 |
| CAS Number | 96036-03-2 |
| SMILES | C[C@@H]1[C@@H]2[C@H](C(=O)N2C(=C1S[C@H]3C[C@H](NC3)C(=O)N(C)C)C(=O)O)[C@@H](C)O |
| Synonyms | Merrem, Merone |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 73 mg/mL (190.37 mM) | |
| Water | 8 mg/mL (20.86 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.08 mL | 130.39 mL | 260.78 mL |
| 0.5 mM | 5.22 mL | 26.08 mL | 52.16 mL |
| 1 mM | 2.61 mL | 13.04 mL | 26.08 mL |
| 5 mM | 0.52 mL | 2.61 mL | 5.22 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
