Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Methoxatin (disodium salt) as the cofactor in bovine plasma amine oxidase from resonance Raman spectroscopy. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21718 |
|---|---|
| Formula | C14H4N2Na2O8 |
| Molecular Weight | 374.17 |
| CAS Number | 122628-50-6 |
| SMILES | O=C(C(N1)=CC(C2=O)=C1C3=C(N=C(C([O-])=O)C=C3C(O)=O)C2=O)[O-].[Na+].[Na+] |
| Synonyms | Pyrroloquinolinequinone disodium salt |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (187.08 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.73 mL | 133.63 mL | 267.26 mL |
| 0.5 mM | 5.35 mL | 26.73 mL | 53.45 mL |
| 1 mM | 2.67 mL | 13.36 mL | 26.73 mL |
| 5 mM | 0.53 mL | 2.67 mL | 5.35 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
