Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Methylene blue (Basic Blue 9) is used as a dye in chromoendoscopy, and is sprayed onto the mucosa of the gastrointestinal tract in order to identify dysplasia, or pre-cancerous lesions. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16612 |
|---|---|
| Formula | C16H18ClN3S |
| Molecular Weight | 319.85 |
| CAS Number | 61-73-4 |
| SMILES | CN(C)C1=CC=C2C(SC(C(C=C/3)=N2)=CC3=[N+](C)/C)=C1.[Cl-] |
| Synonyms | Basic Blue 9; Methylthioninium chloride; CI-52015 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 62 mg/mL (193.83 mM) | |
| Water | Warmed: 62 mg/mL (193.83 mM) | ||
| Ethanol | Warmed: 10 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.26 mL | 156.32 mL | 312.65 mL |
| 0.5 mM | 6.25 mL | 31.26 mL | 62.53 mL |
| 1 mM | 3.13 mL | 15.63 mL | 31.26 mL |
| 5 mM | 0.63 mL | 3.13 mL | 6.25 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
