Loading distributor info...
| Description | Metoclopramide HCl is a selective dopamine D2 receptor antagonist. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A14247 |
|---|---|
| Formula | C14H23Cl2N3O2 |
| Molecular Weight | 336.26 |
| CAS Number | 7232-21-5 |
| SMILES | CCN(CC)CCNC(=O)C1=CC(=C(C=C1OC)N)Cl.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 59 mg/mL (175.46 mM) | |
| Water | 59 mg/mL (175.46 mM) | ||
| Ethanol | 59 mg/mL (175.46 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.74 mL | 148.69 mL | 297.39 mL |
| 0.5 mM | 5.95 mL | 29.74 mL | 59.48 mL |
| 1 mM | 2.97 mL | 14.87 mL | 29.74 mL |
| 5 mM | 0.59 mL | 2.97 mL | 5.95 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
