Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Metoclopramide is a dopamine D2 antagonist that is used as an antiemetic. |
|---|
| Catalog Num | A15161 |
|---|---|
| Formula | C14H22ClN3O2 |
| Molecular Weight | 299.8 |
| CAS Number | 364-62-5 |
| SMILES | CCN(CC)CCNC(=O)C1=CC(=C(C=C1OC)N)Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 53 mg/mL (176.78 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.36 mL | 166.78 mL | 333.56 mL |
| 0.5 mM | 6.67 mL | 33.36 mL | 66.71 mL |
| 1 mM | 3.34 mL | 16.68 mL | 33.36 mL |
| 5 mM | 0.67 mL | 3.34 mL | 6.67 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
