Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Metoprolol succinate is a cardioselective β-adrenergic receptor blocker with IC50 of 42 ng/mL. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11229 |
|---|---|
| Formula | 2C15H25NO3.C4H6O4 |
| Molecular Weight | 652.82 |
| CAS Number | 98418-47-4 |
| SMILES | CC(C)NCC(COC1=CC=C(C=C1)CCOC)O.CC(C)NCC(COC1=CC=C(C=C1)CCOC)O.C(CC(=O)O)C(=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 94 mg/mL (143.99 mM) | |
| Water | 94 mg/mL (143.99 mM) | ||
| Ethanol | 5 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.32 mL | 76.59 mL | 153.18 mL |
| 0.5 mM | 3.06 mL | 15.32 mL | 30.64 mL |
| 1 mM | 1.53 mL | 7.66 mL | 15.32 mL |
| 5 mM | 0.31 mL | 1.53 mL | 3.06 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
