Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MI 2 binds directly to MALT1 and suppresses activated B cell-like diffuse large B cell lymphoma (ABC-DLBCL) in vitro and in vivo. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12928 |
|---|---|
| Formula | C19H17Cl3N4O3 |
| Molecular Weight | 455.72 |
| CAS Number | 1047953-91-2 |
| SMILES | COCCOC1=NN(C(=N1)C2=CC(=C(C=C2)Cl)Cl)C3=CC=C(C=C3)NC(=O)CCl |
| Synonyms | MALT1 inhibitor, MI-2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 77 mg/mL (168.96 mM) | |
| Water | Insoluble | ||
| Ethanol | 77 mg/mL (168.96 mM) | ||
| In vivo | 5%DMSO+30%PEG300+5%Tween-80+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.94 mL | 109.72 mL | 219.43 mL |
| 0.5 mM | 4.39 mL | 21.94 mL | 43.89 mL |
| 1 mM | 2.19 mL | 10.97 mL | 21.94 mL |
| 5 mM | 0.44 mL | 2.19 mL | 4.39 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
