Loading distributor info...
| Description | Midodrine hydrochloride is an ethanolamine derivative that is an adrenergic alpha-1 agonist. It is used as a vasoconstrictor agent in the treatment of hypotension. It improves clinical outcome of chronic hypotension. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17757 |
|---|---|
| Formula | C12H19ClN2O4 |
| Molecular Weight | 290.74 |
| CAS Number | 43218-56-0 |
| SMILES | O=C(NCC(C1=CC(OC)=CC=C1OC)O)CN.[H]Cl |
| Synonyms | Midodrine hydrochloride; Amatine; Orvaten |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 53 mg/mL (182.29 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.39 mL | 171.97 mL | 343.95 mL |
| 0.5 mM | 6.88 mL | 34.39 mL | 68.79 mL |
| 1 mM | 3.44 mL | 17.2 mL | 34.39 mL |
| 5 mM | 0.69 mL | 3.44 mL | 6.88 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
