Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Mifepristone, an antioxidant and glucocorticoid receptor antagonist, demonstrates the ability to suppress activation of NFκB, a nuclear transcription factor that affects the expression of various adhesion molecules and several inflammatory genes. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10591 |
|---|---|
| Formula | C29H35NO2 |
| Molecular Weight | 429.6 |
| CAS Number | 84371-65-3 |
| SMILES | CC#C[C@@]1(CC[C@@H]2[C@@]1(C[C@@H](C3=C4CCC(=O)C=C4CC[C@@H]23)C5=CC=C(C=C5)N(C)C)C)O |
| Synonyms | RU-486, Mifegyne |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (179.24 mM) | |
| Water | Insoluble | ||
| Ethanol | 17 mg/mL (39.57 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.28 mL | 116.39 mL | 232.77 mL |
| 0.5 mM | 4.66 mL | 23.28 mL | 46.55 mL |
| 1 mM | 2.33 mL | 11.64 mL | 23.28 mL |
| 5 mM | 0.47 mL | 2.33 mL | 4.66 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
