Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Mitotane(Lysodren), is an antineoplastic medication used in the treatment of adrenocortical carcinoma. |
|---|
| Catalog Num | A10594 |
|---|---|
| Formula | C14H10Cl4 |
| Molecular Weight | 320.04 |
| CAS Number | 53-19-0 |
| SMILES | C1=CC=C(C(=C1)C(C2=CC=C(C=C2)Cl)C(Cl)Cl)Cl |
| Synonyms | Lysodren, Mitotan |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (174.97 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 56 mg/mL (174.97 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.25 mL | 156.23 mL | 312.46 mL |
| 0.5 mM | 6.25 mL | 31.25 mL | 62.49 mL |
| 1 mM | 3.12 mL | 15.62 mL | 31.25 mL |
| 5 mM | 0.62 mL | 3.12 mL | 6.25 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
