Loading distributor info...
| Description | ML213 is a selective activator of Kv7.2 and Kv7.4 channels, enhances Kv7.2 and Kv7.4 channels with EC50s of 230 and 510 nM, respectively. |
|---|
| Catalog Num | A20068 |
|---|---|
| Formula | C17H23NO |
| Molecular Weight | 257.37 |
| CAS Number | 489402-47-3 |
| SMILES | O=C(C1C(C2)CCC2C1)NC3=C(C)C=C(C)C=C3C |
| Synonyms | ML 213; ML-213; CID-3111211; CID 3111211; CID3111211 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 23 mg/mL (89.36 mM) | |
| Water | Insoluble | ||
| Ethanol | 21 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 38.85 mL | 194.27 mL | 388.55 mL |
| 0.5 mM | 7.77 mL | 38.85 mL | 77.71 mL |
| 1 mM | 3.89 mL | 19.43 mL | 38.85 mL |
| 5 mM | 0.78 mL | 3.89 mL | 7.77 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
