Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ML348 is a selective and reversible lysophospholipase 1 (LYPLA1) inhibitor (IC50 = 210 nM), Exhibits 14-fold selectivity for LYPLA1 over LYPLA2, Also selective over a panel of ~30 other serine hydrolases. |
|---|
| Catalog Num | A16338 |
|---|---|
| Formula | C18H17ClF3N3O3 |
| Molecular Weight | 415.79 |
| CAS Number | 899713-86-1 |
| SMILES | ClC1=C(NC(CN2CCN(C(C3=CC=CO3)=O)CC2)=O)C=C(C(F)(F)F)C=C1 |
| Synonyms | ML-348, ML 348 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (185.19 mM) | |
| Water | Insoluble | ||
| Ethanol | 9 mg/mL (21.65 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.05 mL | 120.25 mL | 240.51 mL |
| 0.5 mM | 4.81 mL | 24.05 mL | 48.1 mL |
| 1 mM | 2.41 mL | 12.03 mL | 24.05 mL |
| 5 mM | 0.48 mL | 2.41 mL | 4.81 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
