Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MLi-2 is a potent, highly selective, orally available, brain penetrant inhibitor of LRRK2 with an IC50 of 0.76 nM. |
|---|
| Catalog Num | A20530 |
|---|---|
| Formula | C21H25N5O2 |
| Molecular Weight | 379.46 |
| CAS Number | 1627091-47-7 |
| SMILES | C[C@@](C1)([H])O[C@](C)([H])CN1C2=CC(C3=NNC4=CC=C(OC5(C)CC5)C=C43)=NC=N2 |
| Synonyms | MLi 2; MLi2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 72 mg/mL (189.74 mM) | |
| Water | 72 mg/mL (189.74 mM) | ||
| Ethanol | 8 mg/mL (21.08 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.35 mL | 131.77 mL | 263.53 mL |
| 0.5 mM | 5.27 mL | 26.35 mL | 52.71 mL |
| 1 mM | 2.64 mL | 13.18 mL | 26.35 mL |
| 5 mM | 0.53 mL | 2.64 mL | 5.27 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
