Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MM-102 is a high-affinity peptidomimetic MLL1 inhibitor with IC50 of 0.4 uM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14315 |
|---|---|
| Formula | C35H49F2N7O4 |
| Molecular Weight | 669.8 |
| CAS Number | 1417329-24-8 |
| SMILES | CCC(CC)(C(=O)N[C@@H](CCCN=C(N)N)C(=O)NC1(CCCC1)C(=O)NC(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F)NC(=O)C(C)C |
| Synonyms | HMTase Inhibitor IX |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 91 mg/mL (135.85 mM) | |
| Water | 91 mg/mL (135.85 mM) | ||
| Ethanol | 91 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.93 mL | 74.65 mL | 149.3 mL |
| 0.5 mM | 2.99 mL | 14.93 mL | 29.86 mL |
| 1 mM | 1.49 mL | 7.46 mL | 14.93 mL |
| 5 mM | 0.3 mL | 1.49 mL | 2.99 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
