Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Mometasone furoate is a glucocorticosteroid used topically to reduce inflammation of the skin or in the airways. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11691 |
|---|---|
| Formula | C27H30Cl2O6 |
| Molecular Weight | 521.43 |
| CAS Number | 83919-23-7 |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CCl)OC(=O)C5=CC=CO5)C)O)Cl)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 5 mg/mL (9.58 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.18 mL | 95.89 mL | 191.78 mL |
| 0.5 mM | 3.84 mL | 19.18 mL | 38.36 mL |
| 1 mM | 1.92 mL | 9.59 mL | 19.18 mL |
| 5 mM | 0.38 mL | 1.92 mL | 3.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
