Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Montelukast (sodium) (MK0476) is a potent, selective CysLT1 receptor antagonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11490 |
|---|---|
| Formula | C35H35ClNNaO3S |
| Molecular Weight | 608.17 |
| CAS Number | 151767-02-1 |
| SMILES | ClC1=CC2=C(C=C1)C=CC(/C=C/C3=CC([C@H](SCC4(CC([O-])=O)CC4)CCC5=CC=CC=C5C(C)(O)C)=CC=C3)=N2.[Na+] |
| Synonyms | MK0476 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 98 mg/mL (161.13 mM) | |
| Water | 98 mg/mL (161.13 mM) | ||
| Ethanol | 98 mg/mL (161.13 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.44 mL | 82.21 mL | 164.43 mL |
| 0.5 mM | 3.29 mL | 16.44 mL | 32.89 mL |
| 1 mM | 1.64 mL | 8.22 mL | 16.44 mL |
| 5 mM | 0.33 mL | 1.64 mL | 3.29 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
