Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MRTX849 is a potent, orally-available, and mutation-selective covalent inhibitor of KRAS G12C with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16482 |
|---|---|
| Formula | C32H35ClFN7O2 |
| Molecular Weight | 604.12 |
| CAS Number | 2326521-71-3 |
| SMILES | CN1CCC[C@H]1COC2=NC3=C(CCN(C3)C4=CC=CC5=C4C(=CC=C5)Cl)C(=N2)N6CCN([C@H](C6)CC#N)C(=O)C(=C)F |
| Synonyms | MRTX 849, MRTX-849 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 87 mg/mL (144.01 mM) | |
| Water | Insoluble | ||
| Ethanol | 44 mg/mL (72.83 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.55 mL | 82.77 mL | 165.53 mL |
| 0.5 mM | 3.31 mL | 16.55 mL | 33.11 mL |
| 1 mM | 1.66 mL | 8.28 mL | 16.55 mL |
| 5 mM | 0.33 mL | 1.66 mL | 3.31 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
