Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MS4078 is an anaplastic lymphoma kinase (ALK) PROTAC (degrader) with a Kd of 19?nM for binding affinity to ALK. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20089 |
|---|---|
| Formula | C45H52ClN9O8S |
| Molecular Weight | 914.47 |
| CAS Number | 2229036-62-6 |
| SMILES | CC(C)S(C1=C(NC2=NC(NC3=C(OC(C)C)C=C(C4CCN(CC(NCCNC5=C(C(N(C6C(NC(CC6)=O)=O)C7=O)=O)C7=CC=C5)=O)CC4)C(C)=C3)=NC=C2Cl)C=CC=C1)(=O)=O |
| Synonyms | MS-4078; MS4078; MS 4078 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 96 mg/mL (104.98 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (2.18 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 10.94 mL | 54.68 mL | 109.35 mL |
| 0.5 mM | 2.19 mL | 10.94 mL | 21.87 mL |
| 1 mM | 1.09 mL | 5.47 mL | 10.94 mL |
| 5 mM | 0.22 mL | 1.09 mL | 2.19 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
