Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Mycophenolic Acid is an immunosuppressant small molecule isolated as a fermentation product from several Penicillium species. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10614 |
|---|---|
| Formula | C17H20O6 |
| Molecular Weight | 320.34 |
| CAS Number | 24280-93-1 |
| SMILES | CC1=C(C(=C(C2=C1COC2=O)O)C/C=C(\C)/CCC(=O)O)OC |
| Synonyms | Mycophenolate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 61 mg/mL (190.42 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (15.6 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.22 mL | 156.08 mL | 312.17 mL |
| 0.5 mM | 6.24 mL | 31.22 mL | 62.43 mL |
| 1 mM | 3.12 mL | 15.61 mL | 31.22 mL |
| 5 mM | 0.62 mL | 3.12 mL | 6.24 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
