Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Naratriptan is a selective 5-HT1 receptor subtype agonist. |
|---|
| Catalog Num | A10624 |
|---|---|
| Formula | C17H25N3O2S |
| Molecular Weight | 335.5 |
| CAS Number | 121679-13-8 |
| SMILES | CNS(=O)(=O)CCC1=CC2=C(C=C1)NC=C2C3CCN(CC3)C |
| Synonyms | Amerge, Naramig |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 71 mg/mL (190.89 mM) | |
| Water | 21 mg/mL (56.46 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.81 mL | 149.03 mL | 298.06 mL |
| 0.5 mM | 5.96 mL | 29.81 mL | 59.61 mL |
| 1 mM | 2.98 mL | 14.9 mL | 29.81 mL |
| 5 mM | 0.6 mL | 2.98 mL | 5.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
