Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Necrostatin-1 is an ATP-competitive, allosteric inhibitor of receptor-interacting protein kinase 1 (RIPK1) (EC50 = 182 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11973 |
|---|---|
| Formula | C13H13N3OS |
| Molecular Weight | 259.33 |
| CAS Number | 4311-88-0 |
| SMILES | CN1C(=O)C(NC1=S)CC2=CNC3=CC=CC=C32 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 43 mg/mL (165.81 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+45% PEG 300+ddH2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 38.56 mL | 192.8 mL | 385.61 mL |
| 0.5 mM | 7.71 mL | 38.56 mL | 77.12 mL |
| 1 mM | 3.86 mL | 19.28 mL | 38.56 mL |
| 5 mM | 0.77 mL | 3.86 mL | 7.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
