Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Necrostatin 2 is a potent necroptosis inhibitor with EC50 of 50 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15327 |
|---|---|
| Formula | C13H12ClN3O2 |
| Molecular Weight | 277.71 |
| CAS Number | 852391-15-2 |
| SMILES | CN1C(=O)C(NC1=O)CC2=CNC3=C2C=CC=C3Cl |
| Synonyms | Necrostatin-2 racemate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (187.24 mM) | |
| Water | Insoluble | ||
| Ethanol | 8 mg/mL (28.8 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.01 mL | 180.04 mL | 360.09 mL |
| 0.5 mM | 7.2 mL | 36.01 mL | 72.02 mL |
| 1 mM | 3.6 mL | 18 mL | 36.01 mL |
| 5 mM | 0.72 mL | 3.6 mL | 7.2 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
