Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Nefiracetam is cognitive enhancer. It activates L/N-type calcium channels, cholinergic, monoaminergic and GABAergic systems. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10631 |
|---|---|
| Formula | C14H18N2O2 |
| Molecular Weight | 246.3 |
| CAS Number | 77191-36-7 |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CN2CCCC2=O |
| Synonyms | DM 9384, DZL-221 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 44 mg/mL (178.64 mM) | |
| Water | 5 mg/mL (20.3 mM) | ||
| Ethanol | 44 mg/mL (178.64 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.6 mL | 203 mL | 406.01 mL |
| 0.5 mM | 8.12 mL | 40.6 mL | 81.2 mL |
| 1 mM | 4.06 mL | 20.3 mL | 40.6 mL |
| 5 mM | 0.81 mL | 4.06 mL | 8.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
