Nepicastat hydrochloride is an inhibitor of dopamine beta-hydroxylase, an enzyme that catalyzes the conversion of dopamine to norepinephrine.
Loading distributor info...
| Description | Nepicastat hydrochloride is an inhibitor of dopamine beta-hydroxylase, an enzyme that catalyzes the conversion of dopamine to norepinephrine. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11172 |
|---|---|
| Formula | C14H15F2N3S.HCl |
| Molecular Weight | 331.81 |
| CAS Number | 170151-24-3 |
| SMILES | C1CC2=C(C=C(C=C2C[C@H]1N3C(=CNC3=S)CN)F)F.Cl |
| Synonyms | RS-25560-197, SYN117 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 59 mg/mL (177.8 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 1% CMC Na | 19 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.14 mL | 150.69 mL | 301.38 mL |
| 0.5 mM | 6.03 mL | 30.14 mL | 60.28 mL |
| 1 mM | 3.01 mL | 15.07 mL | 30.14 mL |
| 5 mM | 0.6 mL | 3.01 mL | 6.03 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
