Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NIH-12848 is a putative phosphatidylinositol 5-phosphate 4-kinase γ (PI5P4Kγ) inhibitor with an IC50 of 1 μM. |
|---|
| Catalog Num | A20476 |
|---|---|
| Formula | C20H14F3N3S |
| Molecular Weight | 385.41 |
| CAS Number | 959551-10-1 |
| SMILES | FC(C1=CC=CC=C1C2=NC(NCC3=CC=CS3)=C4C=CC=CC4=N2)(F)F |
| Synonyms | NIH12848, NIH 12848 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 72 mg/mL (186.81 mM) | |
| Water | Insoluble | ||
| Ethanol | 72 mg/mL (186.81 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.95 mL | 129.73 mL | 259.46 mL |
| 0.5 mM | 5.19 mL | 25.95 mL | 51.89 mL |
| 1 mM | 2.59 mL | 12.97 mL | 25.95 mL |
| 5 mM | 0.52 mL | 2.59 mL | 5.19 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
