Loading distributor info...
| Description | NIK SMI1 is a potent, selective NF-κB inducing kinase (NIK) inhibitor, which inhibits NIK-catalyzed hydrolysis of ATP to ADP with IC50 of 0.23±0.17 nM. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A19308 |
|---|---|
| Formula | C20H19N3O4 |
| Molecular Weight | 365.38 |
| CAS Number | 1660114-31-7 |
| SMILES | O=C(N)C1=NC(C2=CC=CC(C#C[C@]3(O)CCN(C)C3=O)=C2)=CC(OC)=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 64 mg/mL (175.16 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.37 mL | 136.84 mL | 273.69 mL |
| 0.5 mM | 5.47 mL | 27.37 mL | 54.74 mL |
| 1 mM | 2.74 mL | 13.68 mL | 27.37 mL |
| 5 mM | 0.55 mL | 2.74 mL | 5.47 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
