Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NLG919 is an orally available inhibitor of indoleamine 2,3-dioxygenase 1 (IDO1), with potential immunomodulating and antineoplastic activities. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14322 |
|---|---|
| Formula | C18H22N2O |
| Molecular Weight | 282.38 |
| CAS Number | 1402836-58-1 |
| SMILES | C1CCC(CC1)C(CC2C3=CC=CC=C3C4=CN=CN24)O |
| Synonyms | NLG 919, NLG-919 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 13 mg/mL (46.03 mM) | |
| Water | Insoluble | ||
| Ethanol | 26 mg/mL (92.07 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.41 mL | 177.07 mL | 354.13 mL |
| 0.5 mM | 7.08 mL | 35.41 mL | 70.83 mL |
| 1 mM | 3.54 mL | 17.71 mL | 35.41 mL |
| 5 mM | 0.71 mL | 3.54 mL | 7.08 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
