Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Norfloxacin(Norxacin) is a broad-spectrum antibiotic. |
|---|
| Catalog Num | A10652 |
|---|---|
| Formula | C16H18FN3O3 |
| Molecular Weight | 319.3 |
| CAS Number | 70458-96-7 |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCNCC3)F)C(=O)O |
| Synonyms | Chibroxin, MK-366, Baccidal, Sebercim, Zoroxin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 3 mg/mL (9.39 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.32 mL | 156.59 mL | 313.19 mL |
| 0.5 mM | 6.26 mL | 31.32 mL | 62.64 mL |
| 1 mM | 3.13 mL | 15.66 mL | 31.32 mL |
| 5 mM | 0.63 mL | 3.13 mL | 6.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
