Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NSC 228155 is an activator of EGFR, binds to the extracellular region of EGFR and enhance tyrosine phosphorylation of EGFR. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16638 |
|---|---|
| Formula | C11H6N4O4S |
| Molecular Weight | 290.25 |
| CAS Number | 113104-25-9 |
| SMILES | [O-][N+]1=CC=CC=C1SC2=CC=C([N+]([O-])=O)C3=NON=C32 |
| Synonyms | NSC-228155, NSC228155 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 13 mg/mL (44.78 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.45 mL | 172.27 mL | 344.53 mL |
| 0.5 mM | 6.89 mL | 34.45 mL | 68.91 mL |
| 1 mM | 3.45 mL | 17.23 mL | 34.45 mL |
| 5 mM | 0.69 mL | 3.45 mL | 6.89 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
