Loading distributor info...
| Description | NSC697923 is a cell-permeable and selective inhibitor of the Ub-conjugating enzyme (E2) complex Ubc13-Uev1A. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14068 |
|---|---|
| Formula | C11H9NO5S |
| Molecular Weight | 267.26 |
| CAS Number | 343351-67-7 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(O2)[N+](=O)[O-] |
| Synonyms | NSC 697923 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 51 mg/mL (190.82 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+corn oil | 14 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.42 mL | 187.08 mL | 374.17 mL |
| 0.5 mM | 7.48 mL | 37.42 mL | 74.83 mL |
| 1 mM | 3.74 mL | 18.71 mL | 37.42 mL |
| 5 mM | 0.75 mL | 3.74 mL | 7.48 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
