Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Olaquindox is a growth-promoting feed additive for food-producing animals. |
|---|
| Catalog Num | A14807 |
|---|---|
| Formula | C12H13N3O4 |
| Molecular Weight | 263.25 |
| CAS Number | 23696-28-8 |
| SMILES | CC1=C([N+](=O)C2=CC=CC=C2N1[O-])C(=O)NCCO |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 0.01 mg/mL (0.03 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.99 mL | 189.93 mL | 379.87 mL |
| 0.5 mM | 7.6 mL | 37.99 mL | 75.97 mL |
| 1 mM | 3.8 mL | 18.99 mL | 37.99 mL |
| 5 mM | 0.76 mL | 3.8 mL | 7.6 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
