Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | OTX015 is an orally bioavailable, small molecule inhibitor of BRD2, BRD3, and BRD4 (EC50s = 10-19 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13890 |
|---|---|
| Formula | C25H22ClN5O2S |
| Molecular Weight | 491.99 |
| CAS Number | 202590-98-5 |
| SMILES | CC1=C(SC2=C1C(=N[C@H](C3=NN=C(N32)C)CC(=O)NC4=CC=C(C=C4)O)C5=CC=C(C=C5)Cl)C |
| Synonyms | OTX 015, OTX-015 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 89 mg/mL (180.9 mM) | |
| Water | Insoluble | ||
| Ethanol | 89 mg/mL | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.33 mL | 101.63 mL | 203.26 mL |
| 0.5 mM | 4.07 mL | 20.33 mL | 40.65 mL |
| 1 mM | 2.03 mL | 10.16 mL | 20.33 mL |
| 5 mM | 0.41 mL | 2.03 mL | 4.07 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
