Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PD-1/PD-L1 inhibitor 2 is a PD-1/PD-L1 interaction inhibitor. |
|---|
| Catalog Num | A15906 |
|---|---|
| Formula | C25H29N3O3 |
| Molecular Weight | 419.52 |
| CAS Number | 1675203-84-5 |
| SMILES | CC1=C(COC2=NC(OC)=C(CNCCNC(C)=O)C=C2)C=CC=C1C3=CC=CC=C3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 72 mg/mL (171.62 mM) | |
| Water | Insoluble | ||
| Ethanol | 72 mg/mL (171.62 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.84 mL | 119.18 mL | 238.37 mL |
| 0.5 mM | 4.77 mL | 23.84 mL | 47.67 mL |
| 1 mM | 2.38 mL | 11.92 mL | 23.84 mL |
| 5 mM | 0.48 mL | 2.38 mL | 4.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
