Perylene is a polycyclic aromatic hydrocarbon consisting of four fused benzene rings, known for its role as a biochemical assay reagent. Its unique rigid planar structure imparts distinct electronic and optical properties, facilitating applications in biochemistry, materials science, and the development of fluorescent probes. Additionally, Perylene is utilized as a photosensitizer in solar cells, making it valuable for research in various fields including material development and photonics.
Perylene is a polycyclic aromatic hydrocarbon consisting of four fused benzene rings, known for its role as a biochemical assay reagent. Its unique rigid planar structure imparts distinct electronic and optical properties, facilitating applications in biochemistry, materials science, and the development of fluorescent probes. Additionally, Perylene is utilized as a photosensitizer in solar cells, making it valuable for research in various fields including material development and photonics.
Product Information
Catalog Num
A86528
Formula
C20H12
Molecular Weight
252.31
CAS Number
198-55-0
SMILES
C12=CC=CC(C3=CC=CC4=C3C5=CC=C4)=C1C5=CC=C2
Synonyms
Peri-dinaphthalene (purified by sublimation); Perylene
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
