Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | PF 4981517 is a potent and selective inhibitor of CYP3A4 (IC50 values are 0.03, 17 and 70 μM for CYP3A4, CYP3A5 and CYP3A7 respectively). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12544 |
|---|---|
| Formula | C26H32N8 |
| Molecular Weight | 456.59 |
| CAS Number | 1390637-82-7 |
| SMILES | CC1=CC=C(C=C1)C2=C(C=NN2C)C3=NN(C4=C3C(=NC=N4)N5CC[C@@H](C5)N6CCCCC6)C |
| Synonyms | PF4981517, PF-4981517 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (186.16 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.9 mL | 109.51 mL | 219.01 mL |
| 0.5 mM | 4.38 mL | 21.9 mL | 43.8 mL |
| 1 mM | 2.19 mL | 10.95 mL | 21.9 mL |
| 5 mM | 0.44 mL | 2.19 mL | 4.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
