Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Phellodendrine chloride, exhibits immunosuppressive and anti-inflammatory activities. |
|---|
| Catalog Num | A14747 |
|---|---|
| Formula | C20H24NO4Cl |
| Molecular Weight | 377.85 |
| CAS Number | 104112-82-5 |
| SMILES | C[N+]12CCC3=CC(=C(C=C3C1CC4=CC(=C(C=C4C2)OC)O)O)OC.[Cl-] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 34 mg/mL (89.98 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.47 mL | 132.33 mL | 264.66 mL |
| 0.5 mM | 5.29 mL | 26.47 mL | 52.93 mL |
| 1 mM | 2.65 mL | 13.23 mL | 26.47 mL |
| 5 mM | 0.53 mL | 2.65 mL | 5.29 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
