Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Picroside II is an active constituent extracted from the traditional Chinese medicine (TCM) hu-huang-lian. |
|---|
| Catalog Num | A14582 |
|---|---|
| Formula | C23H28O13 |
| Molecular Weight | 512.46 |
| CAS Number | 39012-20-9 |
| SMILES | COC1=C(C=CC(=C1)C(=O)OC2C3C=COC(C3C4(C2O4)CO)OC5C(C(C(C(O5)CO)O)O)O)O |
| Synonyms | Amphicoside II, Vanilloyl catalpol |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 99 mg/mL (193.18 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.51 mL | 97.57 mL | 195.14 mL |
| 0.5 mM | 3.9 mL | 19.51 mL | 39.03 mL |
| 1 mM | 1.95 mL | 9.76 mL | 19.51 mL |
| 5 mM | 0.39 mL | 1.95 mL | 3.9 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
