Loading distributor info...
| Description | PKR Inhibitor is an oxindole/imidazole derivative that binds the ATP-binding site of PKR and blocks autophosphorylation with an IC50 value of 186-210 nM.3 PKR Inhibitor protects human neuroblastoma cells against cell damage triggered by tunicamycin-mediated endoplasmic reticulum stress. |
|---|
| Catalog Num | A13538 |
|---|---|
| Formula | C13H8N4OS |
| Molecular Weight | 268.3 |
| CAS Number | 608512-97-6 |
| SMILES | C1=CC2=C(C\3=C1NC(=O)/C3=C\C4=CN=CN4)SC=N2 |
| Synonyms | C16, GW 506033X |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 13 mg/mL (48.45 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.27 mL | 186.36 mL | 372.72 mL |
| 0.5 mM | 7.45 mL | 37.27 mL | 74.54 mL |
| 1 mM | 3.73 mL | 18.64 mL | 37.27 mL |
| 5 mM | 0.75 mL | 3.73 mL | 7.45 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
