Loading distributor info...
| Description | PNU 282987 (PNU-282,987)is a drug that acts as a potent and selective agonist for the α7 subtype of neural nicotinic acetylcholine receptors. |
|---|
| Catalog Num | A11233 |
|---|---|
| Formula | C14H17ClN2O.HCl |
| Molecular Weight | 301.2 |
| CAS Number | 123464-89-1 |
| SMILES | C1CN2CCC1[C@H](C2)NC(=O)C3=CC=C(C=C3)Cl.Cl |
| Synonyms | PNU-282987, PNU282987 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 44 mg/mL (146.07 mM) | |
| Water | 10 mg/mL (33.19 mM) | ||
| Ethanol | 4 mg/mL (13.27 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.2 mL | 166 mL | 332.01 mL |
| 0.5 mM | 6.64 mL | 33.2 mL | 66.4 mL |
| 1 mM | 3.32 mL | 16.6 mL | 33.2 mL |
| 5 mM | 0.66 mL | 3.32 mL | 6.64 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
