Polyphyllin B
Catalog No.: A14604
Polyphyllin B was extracted from Paris yunnanensis Franch.
Free Delivery on orders over $500
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
Adooq Products cited in reputable paper
Biological Activity
| Discription | Polyphyllin B was extracted from Paris yunnanensis Franch. |
|---|
Product Information
| Catalog Num | A14604 |
|---|---|
| Formula | C44H70O16 |
| Molecular Weight | 855.02 |
| CAS Number | 76296-72-5 |
| SMILES | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(O8)CO)O)O)OC9C(C(C(C(O9)C)O)O)O)O)C)C)C)OC1 |
| Synonyms | Polyphyllin II |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
Solubility
| In vitro | DMSO | 93 mg/mL (108.76 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
Preparing Stock Solutions
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 11.7 mL | 58.48 mL | 116.96 mL |
| 0.5 mM | 2.34 mL | 11.7 mL | 23.39 mL |
| 1 mM | 1.17 mL | 5.85 mL | 11.7 mL |
| 5 mM | 0.23 mL | 1.17 mL | 2.34 mL |
Useful Calculator
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
Keywords: buy Polyphyllin B | Polyphyllin B Supplier | purchase Polyphyllin B | Polyphyllin B cost | Polyphyllin B manufacturer | order Polyphyllin B | Polyphyllin B distributor
| buy 76296-72-5 | 76296-72-5 Supplier | purchase 76296-72-5 | 76296-72-5 cost | 76296-72-5 manufacturer | order 76296-72-5 | 76296-72-5 distributor