Potassium 2,3,3-trimethylindole-5-sulfonate serves as a key intermediate in the synthesis of various dyes, featuring an indole structure with a sulfonate group. This compound is advantageous for coupling reactions, facilitating the attachment to peptides, proteins, nucleic acids, RNA, DNA, carbohydrates, polymers, and small molecules. Its versatility makes it essential for applications in biochemical research and the development of fluorescent labels.
Potassium 2,3,3-trimethylindole-5-sulfonate serves as a key intermediate in the synthesis of various dyes, featuring an indole structure with a sulfonate group. This compound is advantageous for coupling reactions, facilitating the attachment to peptides, proteins, nucleic acids, RNA, DNA, carbohydrates, polymers, and small molecules. Its versatility makes it essential for applications in biochemical research and the development of fluorescent labels.
Product Information
Catalog Num
A44359
Formula
C11H12KNO3S
Molecular Weight
277.38
CAS Number
184351-56-2
SMILES
CC1=NC2=C(C1(C)C)C=C(S(=O)(O[K])=O)C=C2
Synonyms
2,3,3-Trimethylindolenine-5-sulfonic acid potassium salt
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
