Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PQR620 is a novel potent and selective brain penetrant inhibitor of mTORC1/2. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20400 |
|---|---|
| Formula | C21H25F2N7O2 |
| Molecular Weight | 445.47 |
| CAS Number | 1927857-56-4 |
| SMILES | [H][C@]1(CC[C@]([H])2COC1)N2C3=NC(N4[C@]5([H])CC[C@]([H])4COC5)=NC(C6=CN=C(N)C=C6C(F)F)=N3 |
| Synonyms | PQR 620, PQR-620 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 19 mg/mL (42.65 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 2 mg/mL (4.48 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.45 mL | 112.24 mL | 224.48 mL |
| 0.5 mM | 4.49 mL | 22.45 mL | 44.9 mL |
| 1 mM | 2.24 mL | 11.22 mL | 22.45 mL |
| 5 mM | 0.45 mL | 2.24 mL | 4.49 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
