Praeruptorin B
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
Discription | Praeruptorin B, extracted from Umbelliferae Peucedanum praeruptorum. |
---|
Catalog Num | A14735 |
---|---|
Formula | C24H26O7 |
Molecular Weight | 426.46 |
CAS Number | 81740-07-0 |
SMILES | CC=C(C)C(=O)OC1C(C(OC2=C1C3=C(C=C2)C=CC(=O)O3)(C)C)OC(=O)C(=CC)C |
Storage | Store lyophilized at -20ºC, keep desiccated. |
In vitro | DMSO | 28 mg/mL (65.65 mM) | |
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 23.45 mL | 117.24 mL | 234.49 mL |
0.5 mM | 4.69 mL | 23.45 mL | 46.9 mL |
1 mM | 2.34 mL | 11.72 mL | 23.45 mL |
5 mM | 0.47 mL | 2.34 mL | 4.69 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2