Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Promethazine HCl is a potent histamine H1 receptor antagonist. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A14248 |
|---|---|
| Formula | C17H21ClN2S |
| Molecular Weight | 320.88 |
| CAS Number | 58-33-3 |
| SMILES | CC(CN1C2=CC=CC=C2SC3=CC=CC=C31)N(C)C.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (168.29 mM) | |
| Water | 54 mg/mL (168.29 mM) | ||
| Ethanol | 29 mg/mL (90.37 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.16 mL | 155.82 mL | 311.64 mL |
| 0.5 mM | 6.23 mL | 31.16 mL | 62.33 mL |
| 1 mM | 3.12 mL | 15.58 mL | 31.16 mL |
| 5 mM | 0.62 mL | 3.12 mL | 6.23 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
