Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Proxyphylline is a derivative of theophylline which is used as a bronchodilator and for its cardiovascular properties. It selectively antagonizes A1 adenosine receptors (Ki = 82 nM for bovine brain) versus A2 adenosine receptors (Ki = 850 μM for platelets). |
|---|
| Catalog Num | A16821 |
|---|---|
| Formula | C10H14N4O3 |
| Molecular Weight | 238.25 |
| CAS Number | 603-00-9 |
| SMILES | CC(CN1C=NC2=C1C(=O)N(C(=O)N2C)C)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 42 mg/mL (176.29 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.97 mL | 209.86 mL | 419.73 mL |
| 0.5 mM | 8.39 mL | 41.97 mL | 83.95 mL |
| 1 mM | 4.2 mL | 20.99 mL | 41.97 mL |
| 5 mM | 0.84 mL | 4.2 mL | 8.39 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
