Loading distributor info...
| Description | R-7050 (TNF-α Antagonist III) is a tumor necrosis factor receptor (TNFR) antagonist with greater selectivity toward TNFα. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19783 |
|---|---|
| Formula | C16H8ClF3N4S |
| Molecular Weight | 380.77 |
| CAS Number | 303997-35-5 |
| SMILES | FC(F)(C1=NN=C2N1C3=CC(Cl)=CC=C3N=C2SC4=CC=CC=C4)F |
| Synonyms | TNF-α Antagonist III, R7050, R 7050 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 16 mg/mL (42.02 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.26 mL | 131.31 mL | 262.63 mL |
| 0.5 mM | 5.25 mL | 26.26 mL | 52.53 mL |
| 1 mM | 2.63 mL | 13.13 mL | 26.26 mL |
| 5 mM | 0.53 mL | 2.63 mL | 5.25 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
