(R)-(-)-Mandelic acid
Catalog No.: A17863
Mandelic acid, is a natural compound isolated from bitter almonds.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | Mandelic acid, is a natural compound isolated from bitter almonds. |
|---|
| Catalog Num | A17863 |
|---|---|
| Formula | C8H8O3 |
| Molecular Weight | 152.13 |
| CAS Number | 611-71-2 |
| SMILES | O=C(O)[C@H](O)C1=CC=CC=C1 |
| Synonyms | Mandelic acid, (R)-; Mandelic acid, D-; D-2-Phenylglycolic acid; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 26 mg/mL (170.88 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 65.73 mL | 328.67 mL | 657.33 mL |
| 0.5 mM | 13.15 mL | 65.73 mL | 131.47 mL |
| 1 mM | 6.57 mL | 32.87 mL | 65.73 mL |
| 5 mM | 1.31 mL | 6.57 mL | 13.15 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2