Signaling Pathway
R547 is a novel, selective inhibitor of cell cycle and transcriptional cyclin dependent kinases (CDKs) (Ki = 1, 3, and 1 nM for CDK1, CDK2, and CDK4, respectively) with excellent in vitro cellular potency that inhibits the growth of various human tumor cell lines.
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | R547 is a novel, selective inhibitor of cell cycle and transcriptional cyclin dependent kinases (CDKs) (Ki = 1, 3, and 1 nM for CDK1, CDK2, and CDK4, respectively) with excellent in vitro cellular potency that inhibits the growth of various human tumor cell lines. |
||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11190 |
|---|---|
| Formula | C18H21F2N5O4S |
| Molecular Weight | 441.45 |
| CAS Number | 741713-40-6 |
| SMILES | COC1=C(C(=C(C=C1)F)F)C(=O)C2=CN=C(N=C2N)NC3CCN(CC3)S(=O)(=O)C |
| Synonyms | R-547 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 56 mg/mL (126.85 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 1% hydroxyethyl cellulose+0.2% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.65 mL | 113.26 mL | 226.53 mL |
| 0.5 mM | 4.53 mL | 22.65 mL | 45.31 mL |
| 1 mM | 2.27 mL | 11.33 mL | 22.65 mL |
| 5 mM | 0.45 mL | 2.27 mL | 4.53 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
